C18H16ClN3O3 — CID 88993053
[(1R)-1-phenylethyl] N-[5-(6-chloro-3-pyridinyl)-3-methyl-1,2-oxazol-4-yl]carbamate (PubChem CID 88993053) has the molecular formula C18H16ClN3O3 and a molecular weight of 357.80 g/mol. Its IUPAC name is [(1R)-1-phenylethyl] N-[5-(6-chloro-3-pyridinyl)-3-methyl-1,2-oxazol-4-yl]carbamate.
| Compound Name | [(1R)-1-phenylethyl] N-[5-(6-chloro-3-pyridinyl)-3-methyl-1,2-oxazol-4-yl]carbamate |
|---|---|
| PubChem CID | 88993053 |
| Molecular Formula | C18H16ClN3O3 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | [(1R)-1-phenylethyl] N-[5-(6-chloro-3-pyridinyl)-3-methyl-1,2-oxazol-4-yl]carbamate |
| SMILES | Cc1noc(-c2ccc(Cl)nc2)c1NC(=O)O[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C18H16ClN3O3/c1-11-16(17(25-22-11)14-8-9-15(19)20-10-14)21-18(23)24-12(2)13-6-4-3-5-7-13/h3-10,12H,1-2H3,(H,21,23)/t12-/m1/s1 |
| InChIKey | JUBMEXUOUHHSNW-GFCCVEGCSA-N |
| XLogP | 5.01 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|