About N'-(3-methyl-5-phenyl-1,2-oxazol-4-yl)oxamide
N'-(3-methyl-5-phenyl-1,2-oxazol-4-yl)oxamide (PubChem CID 119043716) has the molecular formula C12H11N3O3
and a molecular weight of 245.24 g/mol. Its IUPAC name is N'-(3-methyl-5-phenyl-1,2-oxazol-4-yl)oxamide.
Molecular Properties
| Compound Name | N'-(3-methyl-5-phenyl-1,2-oxazol-4-yl)oxamide |
| PubChem CID | 119043716 |
| Molecular Formula | C12H11N3O3 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | N'-(3-methyl-5-phenyl-1,2-oxazol-4-yl)oxamide |
| SMILES | Cc1noc(-c2ccccc2)c1NC(=O)C(N)=O |
| InChI | InChI=1S/C12H11N3O3/c1-7-9(14-12(17)11(13)16)10(18-15-7)8-5-3-2-4-6-8/h2-6H,1H3,(H2,13,16)(H,14,17) |
| InChIKey | HJQFPGCQVGXWLD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-(3-methyl-5-phenyl-1,2-oxazol-4-yl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3-methyl-5-phenyl-1,2-oxazol-4-yl)oxamide?
The IUPAC name of N'-(3-methyl-5-phenyl-1,2-oxazol-4-yl)oxamide (CID 119043716) is N'-(3-methyl-5-phenyl-1,2-oxazol-4-yl)oxamide.
What is the SMILES notation for N'-(3-methyl-5-phenyl-1,2-oxazol-4-yl)oxamide?
The canonical SMILES for N'-(3-methyl-5-phenyl-1,2-oxazol-4-yl)oxamide is Cc1noc(-c2ccccc2)c1NC(=O)C(N)=O.
What is the InChIKey of N'-(3-methyl-5-phenyl-1,2-oxazol-4-yl)oxamide?
The InChIKey is HJQFPGCQVGXWLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O3/c1-7-9(14-12(17)11(13)16)10(18-15-7)8-5-3-2-4-6-8/h2-6H,1H3,(H2,13,16)(H,14,17).
What are the key properties of N'-(3-methyl-5-phenyl-1,2-oxazol-4-yl)oxamide?
N'-(3-methyl-5-phenyl-1,2-oxazol-4-yl)oxamide has a molecular weight of 245.24 g/mol, XLogP of 1.07, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3-methyl-5-phenyl-1,2-oxazol-4-yl)oxamide is sourced from PubChem (CID 119043716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).