C12H11N3O3 — CID 119043716
N'-(3-methyl-5-phenyl-1,2-oxazol-4-yl)oxamide (PubChem CID 119043716) has the molecular formula C12H11N3O3 and a molecular weight of 245.24 g/mol. Its IUPAC name is N'-(3-methyl-5-phenyl-1,2-oxazol-4-yl)oxamide.
| Compound Name | N'-(3-methyl-5-phenyl-1,2-oxazol-4-yl)oxamide |
|---|---|
| PubChem CID | 119043716 |
| Molecular Formula | C12H11N3O3 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | N'-(3-methyl-5-phenyl-1,2-oxazol-4-yl)oxamide |
| SMILES | Cc1noc(-c2ccccc2)c1NC(=O)C(N)=O |
| InChI | InChI=1S/C12H11N3O3/c1-7-9(14-12(17)11(13)16)10(18-15-7)8-5-3-2-4-6-8/h2-6H,1H3,(H2,13,16)(H,14,17) |
| InChIKey | HJQFPGCQVGXWLD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|