C14H16N2O2 — CID 123973953
4-(3-methyl-5-phenyl-1,2-oxazol-4-yl)butanamide (PubChem CID 123973953) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 4-(3-methyl-5-phenyl-1,2-oxazol-4-yl)butanamide.
| Compound Name | 4-(3-methyl-5-phenyl-1,2-oxazol-4-yl)butanamide |
|---|---|
| PubChem CID | 123973953 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 4-(3-methyl-5-phenyl-1,2-oxazol-4-yl)butanamide |
| SMILES | Cc1noc(-c2ccccc2)c1CCCC(N)=O |
| InChI | InChI=1S/C14H16N2O2/c1-10-12(8-5-9-13(15)17)14(18-16-10)11-6-3-2-4-7-11/h2-4,6-7H,5,8-9H2,1H3,(H2,15,17) |
| InChIKey | MFLXHFOUQUHXEB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |