About 3-[5-(2-methoxyphenyl)-3-methyl-1,2-oxazol-4-yl]propanoic acid
3-[5-(2-methoxyphenyl)-3-methyl-1,2-oxazol-4-yl]propanoic acid (PubChem CID 82302130) has the molecular formula C14H15NO4
and a molecular weight of 261.28 g/mol. Its IUPAC name is 3-[5-(2-methoxyphenyl)-3-methyl-1,2-oxazol-4-yl]propanoic acid.
Analyze 3-[5-(2-methoxyphenyl)-3-methyl-1,2-oxazol-4-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(2-methoxyphenyl)-3-methyl-1,2-oxazol-4-yl]propanoic acid?
The IUPAC name of 3-[5-(2-methoxyphenyl)-3-methyl-1,2-oxazol-4-yl]propanoic acid (CID 82302130) is 3-[5-(2-methoxyphenyl)-3-methyl-1,2-oxazol-4-yl]propanoic acid.
What is the SMILES notation for 3-[5-(2-methoxyphenyl)-3-methyl-1,2-oxazol-4-yl]propanoic acid?
The canonical SMILES for 3-[5-(2-methoxyphenyl)-3-methyl-1,2-oxazol-4-yl]propanoic acid is COc1ccccc1-c1onc(C)c1CCC(=O)O.
What is the InChIKey of 3-[5-(2-methoxyphenyl)-3-methyl-1,2-oxazol-4-yl]propanoic acid?
The InChIKey is LRKOMGIFVQDJCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO4/c1-9-10(7-8-13(16)17)14(19-15-9)11-5-3-4-6-12(11)18-2/h3-6H,7-8H2,1-2H3,(H,16,17).
What are the key properties of 3-[5-(2-methoxyphenyl)-3-methyl-1,2-oxazol-4-yl]propanoic acid?
3-[5-(2-methoxyphenyl)-3-methyl-1,2-oxazol-4-yl]propanoic acid has a molecular weight of 261.28 g/mol, XLogP of 2.68, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(2-methoxyphenyl)-3-methyl-1,2-oxazol-4-yl]propanoic acid is sourced from PubChem (CID 82302130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).