C11H12N2O2 — CID 136765417
2-[4-(aminomethyl)-3-methyl-1,2-oxazol-5-yl]phenol (PubChem CID 136765417) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-[4-(aminomethyl)-3-methyl-1,2-oxazol-5-yl]phenol.
| Compound Name | 2-[4-(aminomethyl)-3-methyl-1,2-oxazol-5-yl]phenol |
|---|---|
| PubChem CID | 136765417 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2-[4-(aminomethyl)-3-methyl-1,2-oxazol-5-yl]phenol |
| SMILES | Cc1noc(-c2ccccc2O)c1CN |
| InChI | InChI=1S/C11H12N2O2/c1-7-9(6-12)11(15-13-7)8-4-2-3-5-10(8)14/h2-5,14H,6,12H2,1H3 |
| InChIKey | FPPDQBPQXQHVSR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |