C5H9N3O — CID 82502400
4-(aminomethyl)-3-methyl-1,2-oxazol-5-amine (PubChem CID 82502400) has the molecular formula C5H9N3O and a molecular weight of 127.15 g/mol. Its IUPAC name is 4-(aminomethyl)-3-methyl-1,2-oxazol-5-amine.
| Compound Name | 4-(aminomethyl)-3-methyl-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 82502400 |
| Molecular Formula | C5H9N3O |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.07 |
| IUPAC Name | 4-(aminomethyl)-3-methyl-1,2-oxazol-5-amine |
| SMILES | Cc1noc(N)c1CN |
| InChI | InChI=1S/C5H9N3O/c1-3-4(2-6)5(7)9-8-3/h2,6-7H2,1H3 |
| InChIKey | NLPSKLBBJOTKER-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |