C7H14N2O — CID 145491487
3,4-dimethyl-1,2-oxazol-5-amine;ethane (PubChem CID 145491487) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is 3,4-dimethyl-1,2-oxazol-5-amine;ethane.
| Compound Name | 3,4-dimethyl-1,2-oxazol-5-amine;ethane |
|---|---|
| PubChem CID | 145491487 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 3,4-dimethyl-1,2-oxazol-5-amine;ethane |
| SMILES | CC.Cc1noc(N)c1C |
| InChI | InChI=1S/C5H8N2O.C2H6/c1-3-4(2)7-8-5(3)6;1-2/h6H2,1-2H3;1-2H3 |
| InChIKey | FONRIRHMWJIBCG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |