C6H9NO — CID 25375
3,4,5-trimethyl-1,2-oxazole (PubChem CID 25375) has the molecular formula C6H9NO and a molecular weight of 111.14 g/mol. Its IUPAC name is 3,4,5-trimethyl-1,2-oxazole.
| Compound Name | 3,4,5-trimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 25375 |
| Molecular Formula | C6H9NO |
| Molecular Weight | 111.14 g/mol |
| Exact Mass | 111.07 |
| IUPAC Name | 3,4,5-trimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1C |
| InChI | InChI=1S/C6H9NO/c1-4-5(2)7-8-6(4)3/h1-3H3 |
| InChIKey | MGHKWBQZEBMFOH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 111.14 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |