About butane;ethane;3,4,5-trimethyl-1,2-oxazole
butane;ethane;3,4,5-trimethyl-1,2-oxazole (PubChem CID 142187309) has the molecular formula C14H31NO
and a molecular weight of 229.41 g/mol. Its IUPAC name is butane;ethane;3,4,5-trimethyl-1,2-oxazole.
Molecular Properties
| Compound Name | butane;ethane;3,4,5-trimethyl-1,2-oxazole |
| PubChem CID | 142187309 |
| Molecular Formula | C14H31NO |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.24 |
| IUPAC Name | butane;ethane;3,4,5-trimethyl-1,2-oxazole |
| SMILES | CC.CC.CCCC.Cc1noc(C)c1C |
| InChI | InChI=1S/C6H9NO.C4H10.2C2H6/c1-4-5(2)7-8-6(4)3;1-3-4-2;2*1-2/h1-3H3;3-4H2,1-2H3;2*1-2H3 |
| InChIKey | OUGIGQMOQUIRHR-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butane;ethane;3,4,5-trimethyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;ethane;3,4,5-trimethyl-1,2-oxazole?
The IUPAC name of butane;ethane;3,4,5-trimethyl-1,2-oxazole (CID 142187309) is butane;ethane;3,4,5-trimethyl-1,2-oxazole.
What is the SMILES notation for butane;ethane;3,4,5-trimethyl-1,2-oxazole?
The canonical SMILES for butane;ethane;3,4,5-trimethyl-1,2-oxazole is CC.CC.CCCC.Cc1noc(C)c1C.
What is the InChIKey of butane;ethane;3,4,5-trimethyl-1,2-oxazole?
The InChIKey is OUGIGQMOQUIRHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO.C4H10.2C2H6/c1-4-5(2)7-8-6(4)3;1-3-4-2;2*1-2/h1-3H3;3-4H2,1-2H3;2*1-2H3.
What are the key properties of butane;ethane;3,4,5-trimethyl-1,2-oxazole?
butane;ethane;3,4,5-trimethyl-1,2-oxazole has a molecular weight of 229.41 g/mol, XLogP of 5.46, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane;ethane;3,4,5-trimethyl-1,2-oxazole is sourced from PubChem (CID 142187309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).