C5H6ClNO — CID 12746085
3-chloro-4,5-dimethyl-1,2-oxazole (PubChem CID 12746085) has the molecular formula C5H6ClNO and a molecular weight of 131.56 g/mol. Its IUPAC name is 3-chloro-4,5-dimethyl-1,2-oxazole.
| Compound Name | 3-chloro-4,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 12746085 |
| Molecular Formula | C5H6ClNO |
| Molecular Weight | 131.56 g/mol |
| Exact Mass | 131.01 |
| IUPAC Name | 3-chloro-4,5-dimethyl-1,2-oxazole |
| SMILES | Cc1onc(Cl)c1C |
| InChI | InChI=1S/C5H6ClNO/c1-3-4(2)8-7-5(3)6/h1-2H3 |
| InChIKey | LZPSBSOLLSDEIY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.56 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |