C6H6NO3- — CID 7018551
4,5-dimethyl-1,2-oxazole-3-carboxylate (PubChem CID 7018551) has the molecular formula C6H6NO3- and a molecular weight of 140.12 g/mol. Its IUPAC name is 4,5-dimethyl-1,2-oxazole-3-carboxylate.
| Compound Name | 4,5-dimethyl-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 7018551 |
| Molecular Formula | C6H6NO3- |
| Molecular Weight | 140.12 g/mol |
| Exact Mass | 140.04 |
| IUPAC Name | 4,5-dimethyl-1,2-oxazole-3-carboxylate |
| SMILES | Cc1onc(C(=O)[O-])c1C |
| InChI | InChI=1S/C6H7NO3/c1-3-4(2)10-7-5(3)6(8)9/h1-2H3,(H,8,9)/p-1 |
| InChIKey | KLPASEZGNSBTBD-UHFFFAOYSA-M |
| XLogP | -0.35 |
| TPSA | 66.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.12 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |