C6H7N3O3 — CID 1489841
5-methyl-1,2-oxazole-3,4-dicarboxamide (PubChem CID 1489841) has the molecular formula C6H7N3O3 and a molecular weight of 169.14 g/mol. Its IUPAC name is 5-methyl-1,2-oxazole-3,4-dicarboxamide.
| Compound Name | 5-methyl-1,2-oxazole-3,4-dicarboxamide |
|---|---|
| PubChem CID | 1489841 |
| Molecular Formula | C6H7N3O3 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | 5-methyl-1,2-oxazole-3,4-dicarboxamide |
| SMILES | Cc1onc(C(N)=O)c1C(N)=O |
| InChI | InChI=1S/C6H7N3O3/c1-2-3(5(7)10)4(6(8)11)9-12-2/h1H3,(H2,7,10)(H2,8,11) |
| InChIKey | BNPNRCBWTDXXLP-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |