C7H8BrNO2 — CID 88995965
2-bromo-1-(3,5-dimethyl-1,2-oxazol-4-yl)ethanone (PubChem CID 88995965) has the molecular formula C7H8BrNO2 and a molecular weight of 218.05 g/mol. Its IUPAC name is 2-bromo-1-(3,5-dimethyl-1,2-oxazol-4-yl)ethanone.
| Compound Name | 2-bromo-1-(3,5-dimethyl-1,2-oxazol-4-yl)ethanone |
|---|---|
| PubChem CID | 88995965 |
| Molecular Formula | C7H8BrNO2 |
| Molecular Weight | 218.05 g/mol |
| Exact Mass | 216.97 |
| IUPAC Name | 2-bromo-1-(3,5-dimethyl-1,2-oxazol-4-yl)ethanone |
| SMILES | Cc1noc(C)c1C(=O)CBr |
| InChI | InChI=1S/C7H8BrNO2/c1-4-7(6(10)3-8)5(2)11-9-4/h3H2,1-2H3 |
| InChIKey | JGIDYHKKMDVKKN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.05 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|