C8H8NO3- — CID 7063565
(E)-3-(3,5-dimethyl-1,2-oxazol-4-yl)prop-2-enoate (PubChem CID 7063565) has the molecular formula C8H8NO3- and a molecular weight of 166.16 g/mol. Its IUPAC name is (E)-3-(3,5-dimethyl-1,2-oxazol-4-yl)prop-2-enoate.
| Compound Name | (E)-3-(3,5-dimethyl-1,2-oxazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7063565 |
| Molecular Formula | C8H8NO3- |
| Molecular Weight | 166.16 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | (E)-3-(3,5-dimethyl-1,2-oxazol-4-yl)prop-2-enoate |
| SMILES | Cc1noc(C)c1/C=C/C(=O)[O-] |
| InChI | InChI=1S/C8H9NO3/c1-5-7(3-4-8(10)11)6(2)12-9-5/h3-4H,1-2H3,(H,10,11)/p-1/b4-3+ |
| InChIKey | BDTVMGBOXLTXBK-ONEGZZNKSA-M |
| XLogP | 0.05 |
| TPSA | 66.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.16 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|