C9H13NO2 — CID 170476060
4-(3,5-dimethyl-1,2-oxazol-4-yl)but-3-en-1-ol (PubChem CID 170476060) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 4-(3,5-dimethyl-1,2-oxazol-4-yl)but-3-en-1-ol.
| Compound Name | 4-(3,5-dimethyl-1,2-oxazol-4-yl)but-3-en-1-ol |
|---|---|
| PubChem CID | 170476060 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 4-(3,5-dimethyl-1,2-oxazol-4-yl)but-3-en-1-ol |
| SMILES | Cc1noc(C)c1C=CCCO |
| InChI | InChI=1S/C9H13NO2/c1-7-9(5-3-4-6-11)8(2)12-10-7/h3,5,11H,4,6H2,1-2H3 |
| InChIKey | PGJJDQXNZQIBAL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |