C8H14N2O2 — CID 28833064
2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]ethanol (PubChem CID 28833064) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]ethanol.
| Compound Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]ethanol |
|---|---|
| PubChem CID | 28833064 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]ethanol |
| SMILES | Cc1noc(C)c1CNCCO |
| InChI | InChI=1S/C8H14N2O2/c1-6-8(5-9-3-4-11)7(2)12-10-6/h9,11H,3-5H2,1-2H3 |
| InChIKey | ZWRKDWQAYCECEQ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|