C11H19N3O2 — CID 79241462
3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]-N-ethylpropanamide (PubChem CID 79241462) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]-N-ethylpropanamide.
| Compound Name | 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]-N-ethylpropanamide |
|---|---|
| PubChem CID | 79241462 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]-N-ethylpropanamide |
| SMILES | CCNC(=O)CCNCc1c(C)noc1C |
| InChI | InChI=1S/C11H19N3O2/c1-4-13-11(15)5-6-12-7-10-8(2)14-16-9(10)3/h12H,4-7H2,1-3H3,(H,13,15) |
| InChIKey | LRKRKGZALGYMNL-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|