About ethyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]acetate
ethyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]acetate (PubChem CID 60812133) has the molecular formula C10H16N2O3
and a molecular weight of 212.25 g/mol. Its IUPAC name is ethyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]acetate.
Analyze ethyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]acetate?
The IUPAC name of ethyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]acetate (CID 60812133) is ethyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]acetate.
What is the SMILES notation for ethyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]acetate?
The canonical SMILES for ethyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]acetate is CCOC(=O)CNCc1c(C)noc1C.
What is the InChIKey of ethyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]acetate?
The InChIKey is NYINXGQUTCWJCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O3/c1-4-14-10(13)6-11-5-9-7(2)12-15-8(9)3/h11H,4-6H2,1-3H3.
What are the key properties of ethyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]acetate?
ethyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]acetate has a molecular weight of 212.25 g/mol, XLogP of 0.94, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]acetate is sourced from PubChem (CID 60812133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).