C9H16N4O2 — CID 83111738
2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]ethylurea (PubChem CID 83111738) has the molecular formula C9H16N4O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]ethylurea.
| Compound Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]ethylurea |
|---|---|
| PubChem CID | 83111738 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]ethylurea |
| SMILES | Cc1noc(C)c1CNCCNC(N)=O |
| InChI | InChI=1S/C9H16N4O2/c1-6-8(7(2)15-13-6)5-11-3-4-12-9(10)14/h11H,3-5H2,1-2H3,(H3,10,12,14) |
| InChIKey | HXPSRKIOWNVCEX-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|