C9H16N2O2 — CID 28780758
N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-methoxyethanamine (PubChem CID 28780758) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-methoxyethanamine.
| Compound Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 28780758 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1c(C)noc1C |
| InChI | InChI=1S/C9H16N2O2/c1-7-9(8(2)13-11-7)6-10-4-5-12-3/h10H,4-6H2,1-3H3 |
| InChIKey | JNWLDIZBFGNEGA-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|