C10H16N2O3 — CID 110646305
ethyl N-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]carbamate (PubChem CID 110646305) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is ethyl N-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]carbamate.
| Compound Name | ethyl N-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 110646305 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | ethyl N-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]carbamate |
| SMILES | CCOC(=O)NCCc1c(C)noc1C |
| InChI | InChI=1S/C10H16N2O3/c1-4-14-10(13)11-6-5-9-7(2)12-15-8(9)3/h4-6H2,1-3H3,(H,11,13) |
| InChIKey | JGWVQMCMUPTACB-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |