C8H11NO — CID 147391521
3,5-dimethyl-4-[(Z)-prop-1-enyl]-1,2-oxazole (PubChem CID 147391521) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is 3,5-dimethyl-4-[(Z)-prop-1-enyl]-1,2-oxazole.
| Compound Name | 3,5-dimethyl-4-[(Z)-prop-1-enyl]-1,2-oxazole |
|---|---|
| PubChem CID | 147391521 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 3,5-dimethyl-4-[(Z)-prop-1-enyl]-1,2-oxazole |
| SMILES | C/C=C\c1c(C)noc1C |
| InChI | InChI=1S/C8H11NO/c1-4-5-8-6(2)9-10-7(8)3/h4-5H,1-3H3/b5-4- |
| InChIKey | DMYPNKJYIDABMY-PLNGDYQASA-N |
| XLogP | 2.32 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |