C7H7Br2NO — CID 89401907
4-(2,2-dibromoethenyl)-3,5-dimethyl-1,2-oxazole (PubChem CID 89401907) has the molecular formula C7H7Br2NO and a molecular weight of 280.95 g/mol. Its IUPAC name is 4-(2,2-dibromoethenyl)-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-(2,2-dibromoethenyl)-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 89401907 |
| Molecular Formula | C7H7Br2NO |
| Molecular Weight | 280.95 g/mol |
| Exact Mass | 278.89 |
| IUPAC Name | 4-(2,2-dibromoethenyl)-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1C=C(Br)Br |
| InChI | InChI=1S/C7H7Br2NO/c1-4-6(3-7(8)9)5(2)11-10-4/h3H,1-2H3 |
| InChIKey | YISKASIEJNZSDI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.95 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |