2-(3,5-dimethyl-1,2-oxazol-4-yl)propanedioic acid

C8H9NO5 — CID 162373151

IUPAC2-(3,5-dimethyl-1,2-oxazol-4-yl)propanedioic acid
SMILESCc1noc(C)c1C(C(=O)O)C(=O)O
InChIInChI=1S/C8H9NO5/c1-3-5(4(2)14-9-3)6(7(10)11)8(12)13/h6H,1-2H3,(H,10,11)(H,12,13)
InChIKeyWRXCBDQHBAXYIX-UHFFFAOYSA-N
MW199.16 g/mol
LogP0.54
Rot. Bonds3

About 2-(3,5-dimethyl-1,2-oxazol-4-yl)propanedioic acid

2-(3,5-dimethyl-1,2-oxazol-4-yl)propanedioic acid (PubChem CID 162373151) has the molecular formula C8H9NO5 and a molecular weight of 199.16 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1,2-oxazol-4-yl)propanedioic acid.

Molecular Properties

Compound Name2-(3,5-dimethyl-1,2-oxazol-4-yl)propanedioic acid
PubChem CID162373151
Molecular FormulaC8H9NO5
Molecular Weight199.16 g/mol
Exact Mass199.05
IUPAC Name2-(3,5-dimethyl-1,2-oxazol-4-yl)propanedioic acid
SMILESCc1noc(C)c1C(C(=O)O)C(=O)O
InChIInChI=1S/C8H9NO5/c1-3-5(4(2)14-9-3)6(7(10)11)8(12)13/h6H,1-2H3,(H,10,11)(H,12,13)
InChIKeyWRXCBDQHBAXYIX-UHFFFAOYSA-N
XLogP0.54
TPSA100.63 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.16
LogP ≤ 50.54
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2-(3,5-dimethyl-1,2-oxazol-4-yl)propanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,5-dimethyl-1,2-oxazol-4-yl)propanedioic acid?
The IUPAC name of 2-(3,5-dimethyl-1,2-oxazol-4-yl)propanedioic acid (CID 162373151) is 2-(3,5-dimethyl-1,2-oxazol-4-yl)propanedioic acid.
What is the SMILES notation for 2-(3,5-dimethyl-1,2-oxazol-4-yl)propanedioic acid?
The canonical SMILES for 2-(3,5-dimethyl-1,2-oxazol-4-yl)propanedioic acid is Cc1noc(C)c1C(C(=O)O)C(=O)O.
What is the InChIKey of 2-(3,5-dimethyl-1,2-oxazol-4-yl)propanedioic acid?
The InChIKey is WRXCBDQHBAXYIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO5/c1-3-5(4(2)14-9-3)6(7(10)11)8(12)13/h6H,1-2H3,(H,10,11)(H,12,13).
What are the key properties of 2-(3,5-dimethyl-1,2-oxazol-4-yl)propanedioic acid?
2-(3,5-dimethyl-1,2-oxazol-4-yl)propanedioic acid has a molecular weight of 199.16 g/mol, XLogP of 0.54, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethyl-1,2-oxazol-4-yl)propanedioic acid is sourced from PubChem (CID 162373151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).