About 2-(dimethylamino)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetic acid
2-(dimethylamino)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetic acid (PubChem CID 82398410) has the molecular formula C9H14N2O3
and a molecular weight of 198.22 g/mol. Its IUPAC name is 2-(dimethylamino)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(dimethylamino)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetic acid |
| PubChem CID | 82398410 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 2-(dimethylamino)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetic acid |
| SMILES | Cc1noc(C)c1C(C(=O)O)N(C)C |
| InChI | InChI=1S/C9H14N2O3/c1-5-7(6(2)14-10-5)8(9(12)13)11(3)4/h8H,1-4H3,(H,12,13) |
| InChIKey | LEDBYTPJTOUVSI-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(dimethylamino)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetic acid?
The IUPAC name of 2-(dimethylamino)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetic acid (CID 82398410) is 2-(dimethylamino)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetic acid.
What is the SMILES notation for 2-(dimethylamino)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetic acid?
The canonical SMILES for 2-(dimethylamino)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetic acid is Cc1noc(C)c1C(C(=O)O)N(C)C.
What is the InChIKey of 2-(dimethylamino)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetic acid?
The InChIKey is LEDBYTPJTOUVSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O3/c1-5-7(6(2)14-10-5)8(9(12)13)11(3)4/h8H,1-4H3,(H,12,13).
What are the key properties of 2-(dimethylamino)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetic acid?
2-(dimethylamino)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetic acid has a molecular weight of 198.22 g/mol, XLogP of 0.98, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-2-(3,5-dimethyl-1,2-oxazol-4-yl)acetic acid is sourced from PubChem (CID 82398410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).