C7H10N2O3 — CID 149149378
(3,5-dimethyl-1,2-oxazol-4-yl)-methylcarbamic acid (PubChem CID 149149378) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is (3,5-dimethyl-1,2-oxazol-4-yl)-methylcarbamic acid.
| Compound Name | (3,5-dimethyl-1,2-oxazol-4-yl)-methylcarbamic acid |
|---|---|
| PubChem CID | 149149378 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | (3,5-dimethyl-1,2-oxazol-4-yl)-methylcarbamic acid |
| SMILES | Cc1noc(C)c1N(C)C(=O)O |
| InChI | InChI=1S/C7H10N2O3/c1-4-6(5(2)12-8-4)9(3)7(10)11/h1-3H3,(H,10,11) |
| InChIKey | PPHIOKQGPKXZSZ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |