2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl-methylamino]acetic acid

C10H16N2O3 — CID 83821117

IUPAC2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl-methylamino]acetic acid
SMILESCc1noc(C)c1CCN(C)CC(=O)O
InChIInChI=1S/C10H16N2O3/c1-7-9(8(2)15-11-7)4-5-12(3)6-10(13)14/h4-6H2,1-3H3,(H,13,14)
InChIKeyWYJHSQHAXFGBPC-UHFFFAOYSA-N
MW212.25 g/mol
LogP0.85
Rot. Bonds5

About 2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl-methylamino]acetic acid

2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl-methylamino]acetic acid (PubChem CID 83821117) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl-methylamino]acetic acid.

Molecular Properties

Compound Name2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl-methylamino]acetic acid
PubChem CID83821117
Molecular FormulaC10H16N2O3
Molecular Weight212.25 g/mol
Exact Mass212.12
IUPAC Name2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl-methylamino]acetic acid
SMILESCc1noc(C)c1CCN(C)CC(=O)O
InChIInChI=1S/C10H16N2O3/c1-7-9(8(2)15-11-7)4-5-12(3)6-10(13)14/h4-6H2,1-3H3,(H,13,14)
InChIKeyWYJHSQHAXFGBPC-UHFFFAOYSA-N
XLogP0.85
TPSA66.57 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.25
LogP ≤ 50.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl-methylamino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl-methylamino]acetic acid?
The IUPAC name of 2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl-methylamino]acetic acid (CID 83821117) is 2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl-methylamino]acetic acid.
What is the SMILES notation for 2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl-methylamino]acetic acid?
The canonical SMILES for 2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl-methylamino]acetic acid is Cc1noc(C)c1CCN(C)CC(=O)O.
What is the InChIKey of 2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl-methylamino]acetic acid?
The InChIKey is WYJHSQHAXFGBPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O3/c1-7-9(8(2)15-11-7)4-5-12(3)6-10(13)14/h4-6H2,1-3H3,(H,13,14).
What are the key properties of 2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl-methylamino]acetic acid?
2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl-methylamino]acetic acid has a molecular weight of 212.25 g/mol, XLogP of 0.85, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl-methylamino]acetic acid is sourced from PubChem (CID 83821117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).