About (2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid
(2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid (PubChem CID 92845870) has the molecular formula C9H13NO3
and a molecular weight of 183.21 g/mol. Its IUPAC name is (2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid.
Analyze (2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid?
The IUPAC name of (2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid (CID 92845870) is (2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid.
What is the SMILES notation for (2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid?
The canonical SMILES for (2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid is Cc1noc(C)c1C[C@@H](C)C(=O)O.
What is the InChIKey of (2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid?
The InChIKey is PDYABMIUDRMKQX-RXMQYKEDSA-N. The full InChI is InChI=1S/C9H13NO3/c1-5(9(11)12)4-8-6(2)10-13-7(8)3/h5H,4H2,1-3H3,(H,11,12)/t5-/m1/s1.
What are the key properties of (2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid?
(2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid has a molecular weight of 183.21 g/mol, XLogP of 1.55, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid is sourced from PubChem (CID 92845870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).