(2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid

C9H13NO3 — CID 92845870

IUPAC(2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid
SMILESCc1noc(C)c1C[C@@H](C)C(=O)O
InChIInChI=1S/C9H13NO3/c1-5(9(11)12)4-8-6(2)10-13-7(8)3/h5H,4H2,1-3H3,(H,11,12)/t5-/m1/s1
InChIKeyPDYABMIUDRMKQX-RXMQYKEDSA-N
MW183.21 g/mol
LogP1.55
Rot. Bonds3

About (2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid

(2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid (PubChem CID 92845870) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is (2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid.

Molecular Properties

Compound Name(2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid
PubChem CID92845870
Molecular FormulaC9H13NO3
Molecular Weight183.21 g/mol
Exact Mass183.09
IUPAC Name(2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid
SMILESCc1noc(C)c1C[C@@H](C)C(=O)O
InChIInChI=1S/C9H13NO3/c1-5(9(11)12)4-8-6(2)10-13-7(8)3/h5H,4H2,1-3H3,(H,11,12)/t5-/m1/s1
InChIKeyPDYABMIUDRMKQX-RXMQYKEDSA-N
XLogP1.55
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.21
LogP ≤ 51.55
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid?
The IUPAC name of (2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid (CID 92845870) is (2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid.
What is the SMILES notation for (2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid?
The canonical SMILES for (2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid is Cc1noc(C)c1C[C@@H](C)C(=O)O.
What is the InChIKey of (2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid?
The InChIKey is PDYABMIUDRMKQX-RXMQYKEDSA-N. The full InChI is InChI=1S/C9H13NO3/c1-5(9(11)12)4-8-6(2)10-13-7(8)3/h5H,4H2,1-3H3,(H,11,12)/t5-/m1/s1.
What are the key properties of (2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid?
(2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid has a molecular weight of 183.21 g/mol, XLogP of 1.55, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoic acid is sourced from PubChem (CID 92845870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).