About 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfonyl]propanoic acid
2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfonyl]propanoic acid (PubChem CID 82180799) has the molecular formula C9H13NO5S
and a molecular weight of 247.27 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfonyl]propanoic acid.
Analyze 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfonyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfonyl]propanoic acid?
The IUPAC name of 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfonyl]propanoic acid (CID 82180799) is 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfonyl]propanoic acid.
What is the SMILES notation for 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfonyl]propanoic acid?
The canonical SMILES for 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfonyl]propanoic acid is Cc1noc(C)c1CS(=O)(=O)C(C)C(=O)O.
What is the InChIKey of 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfonyl]propanoic acid?
The InChIKey is LTXSFMFAFFSMCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO5S/c1-5-8(6(2)15-10-5)4-16(13,14)7(3)9(11)12/h7H,4H2,1-3H3,(H,11,12).
What are the key properties of 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfonyl]propanoic acid?
2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfonyl]propanoic acid has a molecular weight of 247.27 g/mol, XLogP of 0.68, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfonyl]propanoic acid is sourced from PubChem (CID 82180799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).