About (2R)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]propanoic acid
(2R)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]propanoic acid (PubChem CID 104875222) has the molecular formula C9H13NO4
and a molecular weight of 199.21 g/mol. Its IUPAC name is (2R)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]propanoic acid.
Analyze (2R)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]propanoic acid?
The IUPAC name of (2R)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]propanoic acid (CID 104875222) is (2R)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]propanoic acid.
What is the SMILES notation for (2R)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]propanoic acid?
The canonical SMILES for (2R)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]propanoic acid is Cc1noc(C)c1CO[C@H](C)C(=O)O.
What is the InChIKey of (2R)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]propanoic acid?
The InChIKey is BQQVGDIMIUBLIX-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H13NO4/c1-5-8(6(2)14-10-5)4-13-7(3)9(11)12/h7H,4H2,1-3H3,(H,11,12)/t7-/m1/s1.
What are the key properties of (2R)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]propanoic acid?
(2R)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]propanoic acid has a molecular weight of 199.21 g/mol, XLogP of 1.28, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]propanoic acid is sourced from PubChem (CID 104875222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).