5-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-methylbenzoic acid

C14H15NO4 — CID 82165950

IUPAC5-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-methylbenzoic acid
SMILESCc1ccc(OCc2c(C)noc2C)cc1C(=O)O
InChIInChI=1S/C14H15NO4/c1-8-4-5-11(6-12(8)14(16)17)18-7-13-9(2)15-19-10(13)3/h4-6H,7H2,1-3H3,(H,16,17)
InChIKeyMSSPKNQHMFYFTK-UHFFFAOYSA-N
MW261.28 g/mol
LogP2.88
Rot. Bonds4

About 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-methylbenzoic acid

5-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-methylbenzoic acid (PubChem CID 82165950) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-methylbenzoic acid.

Molecular Properties

Compound Name5-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-methylbenzoic acid
PubChem CID82165950
Molecular FormulaC14H15NO4
Molecular Weight261.28 g/mol
Exact Mass261.10
IUPAC Name5-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-methylbenzoic acid
SMILESCc1ccc(OCc2c(C)noc2C)cc1C(=O)O
InChIInChI=1S/C14H15NO4/c1-8-4-5-11(6-12(8)14(16)17)18-7-13-9(2)15-19-10(13)3/h4-6H,7H2,1-3H3,(H,16,17)
InChIKeyMSSPKNQHMFYFTK-UHFFFAOYSA-N
XLogP2.88
TPSA72.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.28
LogP ≤ 52.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-methylbenzoic acid?
The IUPAC name of 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-methylbenzoic acid (CID 82165950) is 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-methylbenzoic acid.
What is the SMILES notation for 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-methylbenzoic acid?
The canonical SMILES for 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-methylbenzoic acid is Cc1ccc(OCc2c(C)noc2C)cc1C(=O)O.
What is the InChIKey of 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-methylbenzoic acid?
The InChIKey is MSSPKNQHMFYFTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO4/c1-8-4-5-11(6-12(8)14(16)17)18-7-13-9(2)15-19-10(13)3/h4-6H,7H2,1-3H3,(H,16,17).
What are the key properties of 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-methylbenzoic acid?
5-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-methylbenzoic acid has a molecular weight of 261.28 g/mol, XLogP of 2.88, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-methylbenzoic acid is sourced from PubChem (CID 82165950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).