4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-hydroxybenzoic acid

C13H13NO5 — CID 10264729

IUPAC4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-hydroxybenzoic acid
SMILESCc1noc(C)c1COc1ccc(C(=O)O)c(O)c1
InChIInChI=1S/C13H13NO5/c1-7-11(8(2)19-14-7)6-18-9-3-4-10(13(16)17)12(15)5-9/h3-5,15H,6H2,1-2H3,(H,16,17)
InChIKeyTXYFLBHFAXODPS-UHFFFAOYSA-N
MW263.25 g/mol
LogP2.27
Rot. Bonds4

About 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-hydroxybenzoic acid

4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-hydroxybenzoic acid (PubChem CID 10264729) has the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-hydroxybenzoic acid.

Molecular Properties

Compound Name4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-hydroxybenzoic acid
PubChem CID10264729
Molecular FormulaC13H13NO5
Molecular Weight263.25 g/mol
Exact Mass263.08
IUPAC Name4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-hydroxybenzoic acid
SMILESCc1noc(C)c1COc1ccc(C(=O)O)c(O)c1
InChIInChI=1S/C13H13NO5/c1-7-11(8(2)19-14-7)6-18-9-3-4-10(13(16)17)12(15)5-9/h3-5,15H,6H2,1-2H3,(H,16,17)
InChIKeyTXYFLBHFAXODPS-UHFFFAOYSA-N
XLogP2.27
TPSA92.79 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.25
LogP ≤ 52.27
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-hydroxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-hydroxybenzoic acid?
The IUPAC name of 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-hydroxybenzoic acid (CID 10264729) is 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-hydroxybenzoic acid.
What is the SMILES notation for 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-hydroxybenzoic acid?
The canonical SMILES for 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-hydroxybenzoic acid is Cc1noc(C)c1COc1ccc(C(=O)O)c(O)c1.
What is the InChIKey of 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-hydroxybenzoic acid?
The InChIKey is TXYFLBHFAXODPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO5/c1-7-11(8(2)19-14-7)6-18-9-3-4-10(13(16)17)12(15)5-9/h3-5,15H,6H2,1-2H3,(H,16,17).
What are the key properties of 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-hydroxybenzoic acid?
4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-hydroxybenzoic acid has a molecular weight of 263.25 g/mol, XLogP of 2.27, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-2-hydroxybenzoic acid is sourced from PubChem (CID 10264729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).