C20H19NO4 — CID 2364688
(3,5-dimethyl-1,2-oxazol-4-yl)methyl 2-(4-phenylphenoxy)acetate (PubChem CID 2364688) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is (3,5-dimethyl-1,2-oxazol-4-yl)methyl 2-(4-phenylphenoxy)acetate.
| Compound Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl 2-(4-phenylphenoxy)acetate |
|---|---|
| PubChem CID | 2364688 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl 2-(4-phenylphenoxy)acetate |
| SMILES | Cc1noc(C)c1COC(=O)COc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H19NO4/c1-14-19(15(2)25-21-14)12-24-20(22)13-23-18-10-8-17(9-11-18)16-6-4-3-5-7-16/h3-11H,12-13H2,1-2H3 |
| InChIKey | HOEQCMHPDLIIMA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |