C17H21NO5 — CID 55306569
(3,5-dimethyl-1,2-oxazol-4-yl)methyl 4-(4-methoxyphenoxy)butanoate (PubChem CID 55306569) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is (3,5-dimethyl-1,2-oxazol-4-yl)methyl 4-(4-methoxyphenoxy)butanoate.
| Compound Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl 4-(4-methoxyphenoxy)butanoate |
|---|---|
| PubChem CID | 55306569 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl 4-(4-methoxyphenoxy)butanoate |
| SMILES | COc1ccc(OCCCC(=O)OCc2c(C)noc2C)cc1 |
| InChI | InChI=1S/C17H21NO5/c1-12-16(13(2)23-18-12)11-22-17(19)5-4-10-21-15-8-6-14(20-3)7-9-15/h6-9H,4-5,10-11H2,1-3H3 |
| InChIKey | LFNWHTGXUBKPKM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|