C16H15NO3 — CID 43326466
7-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]naphthalen-2-ol (PubChem CID 43326466) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 7-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]naphthalen-2-ol.
| Compound Name | 7-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]naphthalen-2-ol |
|---|---|
| PubChem CID | 43326466 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 7-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]naphthalen-2-ol |
| SMILES | Cc1noc(C)c1COc1ccc2ccc(O)cc2c1 |
| InChI | InChI=1S/C16H15NO3/c1-10-16(11(2)20-17-10)9-19-15-6-4-12-3-5-14(18)7-13(12)8-15/h3-8,18H,9H2,1-2H3 |
| InChIKey | PKAKHSZNOQHTRP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |