About methyl 4-ethenyl-5-methyl-1,2-oxazole-3-carboxylate
methyl 4-ethenyl-5-methyl-1,2-oxazole-3-carboxylate (PubChem CID 152577748) has the molecular formula C8H9NO3
and a molecular weight of 167.16 g/mol. Its IUPAC name is methyl 4-ethenyl-5-methyl-1,2-oxazole-3-carboxylate.
Analyze methyl 4-ethenyl-5-methyl-1,2-oxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-ethenyl-5-methyl-1,2-oxazole-3-carboxylate?
The IUPAC name of methyl 4-ethenyl-5-methyl-1,2-oxazole-3-carboxylate (CID 152577748) is methyl 4-ethenyl-5-methyl-1,2-oxazole-3-carboxylate.
What is the SMILES notation for methyl 4-ethenyl-5-methyl-1,2-oxazole-3-carboxylate?
The canonical SMILES for methyl 4-ethenyl-5-methyl-1,2-oxazole-3-carboxylate is C=Cc1c(C(=O)OC)noc1C.
What is the InChIKey of methyl 4-ethenyl-5-methyl-1,2-oxazole-3-carboxylate?
The InChIKey is YSVBTANYFUGPMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO3/c1-4-6-5(2)12-9-7(6)8(10)11-3/h4H,1H2,2-3H3.
What are the key properties of methyl 4-ethenyl-5-methyl-1,2-oxazole-3-carboxylate?
methyl 4-ethenyl-5-methyl-1,2-oxazole-3-carboxylate has a molecular weight of 167.16 g/mol, XLogP of 1.41, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-ethenyl-5-methyl-1,2-oxazole-3-carboxylate is sourced from PubChem (CID 152577748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).