C14H17ClFNO3 — CID 123960754
methyl 3-(2-chloro-4-fluoroocta-1,3-dien-3-yl)-5-methyl-1,2-oxazole-4-carboxylate (PubChem CID 123960754) has the molecular formula C14H17ClFNO3 and a molecular weight of 301.75 g/mol. Its IUPAC name is methyl 3-(2-chloro-4-fluoroocta-1,3-dien-3-yl)-5-methyl-1,2-oxazole-4-carboxylate.
| Compound Name | methyl 3-(2-chloro-4-fluoroocta-1,3-dien-3-yl)-5-methyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 123960754 |
| Molecular Formula | C14H17ClFNO3 |
| Molecular Weight | 301.75 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | methyl 3-(2-chloro-4-fluoroocta-1,3-dien-3-yl)-5-methyl-1,2-oxazole-4-carboxylate |
| SMILES | C=C(Cl)C(=C(F)CCCC)c1noc(C)c1C(=O)OC |
| InChI | InChI=1S/C14H17ClFNO3/c1-5-6-7-10(16)11(8(2)15)13-12(14(18)19-4)9(3)20-17-13/h2,5-7H2,1,3-4H3 |
| InChIKey | CVSLKWLFZQKQKD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.75 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|