About methyl 5,6-dihydro-4H-pyrrolo[3,4-d][1,2]oxazole-3-carboxylate
methyl 5,6-dihydro-4H-pyrrolo[3,4-d][1,2]oxazole-3-carboxylate (PubChem CID 117274239) has the molecular formula C7H8N2O3
and a molecular weight of 168.15 g/mol. Its IUPAC name is methyl 5,6-dihydro-4H-pyrrolo[3,4-d][1,2]oxazole-3-carboxylate.
Analyze methyl 5,6-dihydro-4H-pyrrolo[3,4-d][1,2]oxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5,6-dihydro-4H-pyrrolo[3,4-d][1,2]oxazole-3-carboxylate?
The IUPAC name of methyl 5,6-dihydro-4H-pyrrolo[3,4-d][1,2]oxazole-3-carboxylate (CID 117274239) is methyl 5,6-dihydro-4H-pyrrolo[3,4-d][1,2]oxazole-3-carboxylate.
What is the SMILES notation for methyl 5,6-dihydro-4H-pyrrolo[3,4-d][1,2]oxazole-3-carboxylate?
The canonical SMILES for methyl 5,6-dihydro-4H-pyrrolo[3,4-d][1,2]oxazole-3-carboxylate is COC(=O)c1noc2c1CNC2.
What is the InChIKey of methyl 5,6-dihydro-4H-pyrrolo[3,4-d][1,2]oxazole-3-carboxylate?
The InChIKey is UOGXXJXNOGWRPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O3/c1-11-7(10)6-4-2-8-3-5(4)12-9-6/h8H,2-3H2,1H3.
What are the key properties of methyl 5,6-dihydro-4H-pyrrolo[3,4-d][1,2]oxazole-3-carboxylate?
methyl 5,6-dihydro-4H-pyrrolo[3,4-d][1,2]oxazole-3-carboxylate has a molecular weight of 168.15 g/mol, XLogP of 0.06, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5,6-dihydro-4H-pyrrolo[3,4-d][1,2]oxazole-3-carboxylate is sourced from PubChem (CID 117274239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).