C8H11NO4 — CID 129045730
dimethyl 2,5-dihydro-1H-pyrrole-3,4-dicarboxylate (PubChem CID 129045730) has the molecular formula C8H11NO4 and a molecular weight of 185.18 g/mol. Its IUPAC name is dimethyl 2,5-dihydro-1H-pyrrole-3,4-dicarboxylate.
| Compound Name | dimethyl 2,5-dihydro-1H-pyrrole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 129045730 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | dimethyl 2,5-dihydro-1H-pyrrole-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)CNC1 |
| InChI | InChI=1S/C8H11NO4/c1-12-7(10)5-3-9-4-6(5)8(11)13-2/h9H,3-4H2,1-2H3 |
| InChIKey | AANJXOAYDBJPBM-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |