C32H32O12 — CID 13068956
hexamethyl pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),4,9(14),11,15(20),17-hexaene-4,5,11,12,17,18-hexacarboxylate (PubChem CID 13068956) has the molecular formula C32H32O12 and a molecular weight of 608.60 g/mol. Its IUPAC name is hexamethyl pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),4,9(14),11,15(20),17-hexaene-4,5,11,12,17,18-hexacarboxylate.
| Compound Name | hexamethyl pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),4,9(14),11,15(20),17-hexaene-4,5,11,12,17,18-hexacarboxylate |
|---|---|
| PubChem CID | 13068956 |
| Molecular Formula | C32H32O12 |
| Molecular Weight | 608.60 g/mol |
| Exact Mass | 608.19 |
| IUPAC Name | hexamethyl pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),4,9(14),11,15(20),17-hexaene-4,5,11,12,17,18-hexacarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)CC2=C(C1)C1C3=C(CC(C(=O)OC)=C(C(=O)OC)C3)C2C2=C1CC(C(=O)OC)=C(C(=O)OC)C2 |
| InChI | InChI=1S/C32H32O12/c1-39-27(33)19-7-13-14(8-20(19)28(34)40-2)26-17-11-23(31(37)43-5)21(29(35)41-3)9-15(17)25(13)16-10-22(30(36)42-4)24(12-18(16)26)32(38)44-6/h25-26H,7-12H2,1-6H3 |
| InChIKey | LNYDBOATTZFMMJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.60 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|