About methyl 2-amino-3,3-dimethylcyclopentene-1-carboxylate
methyl 2-amino-3,3-dimethylcyclopentene-1-carboxylate (PubChem CID 90258796) has the molecular formula C9H15NO2
and a molecular weight of 169.22 g/mol. Its IUPAC name is methyl 2-amino-3,3-dimethylcyclopentene-1-carboxylate.
Analyze methyl 2-amino-3,3-dimethylcyclopentene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-3,3-dimethylcyclopentene-1-carboxylate?
The IUPAC name of methyl 2-amino-3,3-dimethylcyclopentene-1-carboxylate (CID 90258796) is methyl 2-amino-3,3-dimethylcyclopentene-1-carboxylate.
What is the SMILES notation for methyl 2-amino-3,3-dimethylcyclopentene-1-carboxylate?
The canonical SMILES for methyl 2-amino-3,3-dimethylcyclopentene-1-carboxylate is COC(=O)C1=C(N)C(C)(C)CC1.
What is the InChIKey of methyl 2-amino-3,3-dimethylcyclopentene-1-carboxylate?
The InChIKey is SYZPMOIQLAGXTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2/c1-9(2)5-4-6(7(9)10)8(11)12-3/h4-5,10H2,1-3H3.
What are the key properties of methyl 2-amino-3,3-dimethylcyclopentene-1-carboxylate?
methyl 2-amino-3,3-dimethylcyclopentene-1-carboxylate has a molecular weight of 169.22 g/mol, XLogP of 1.19, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-3,3-dimethylcyclopentene-1-carboxylate is sourced from PubChem (CID 90258796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).