C14H25O6P — CID 11023638
methyl 2-diethoxyphosphoryloxy-4,4-dimethylcyclohexene-1-carboxylate (PubChem CID 11023638) has the molecular formula C14H25O6P and a molecular weight of 320.32 g/mol. Its IUPAC name is methyl 2-diethoxyphosphoryloxy-4,4-dimethylcyclohexene-1-carboxylate.
| Compound Name | methyl 2-diethoxyphosphoryloxy-4,4-dimethylcyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 11023638 |
| Molecular Formula | C14H25O6P |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | methyl 2-diethoxyphosphoryloxy-4,4-dimethylcyclohexene-1-carboxylate |
| SMILES | CCOP(=O)(OCC)OC1=C(C(=O)OC)CCC(C)(C)C1 |
| InChI | InChI=1S/C14H25O6P/c1-6-18-21(16,19-7-2)20-12-10-14(3,4)9-8-11(12)13(15)17-5/h6-10H2,1-5H3 |
| InChIKey | LXOQUIZOXKFBLI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|