C16H27O6P — CID 15701441
methyl (1S,4S)-3-diethoxyphosphoryloxy-4,7,7-trimethylbicyclo[2.2.1]hept-2-ene-2-carboxylate (PubChem CID 15701441) has the molecular formula C16H27O6P and a molecular weight of 346.36 g/mol. Its IUPAC name is methyl (1S,4S)-3-diethoxyphosphoryloxy-4,7,7-trimethylbicyclo[2.2.1]hept-2-ene-2-carboxylate.
| Compound Name | methyl (1S,4S)-3-diethoxyphosphoryloxy-4,7,7-trimethylbicyclo[2.2.1]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 15701441 |
| Molecular Formula | C16H27O6P |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | methyl (1S,4S)-3-diethoxyphosphoryloxy-4,7,7-trimethylbicyclo[2.2.1]hept-2-ene-2-carboxylate |
| SMILES | CCOP(=O)(OCC)OC1=C(C(=O)OC)[C@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C16H27O6P/c1-7-20-23(18,21-8-2)22-13-12(14(17)19-6)11-9-10-16(13,5)15(11,3)4/h11H,7-10H2,1-6H3/t11-,16-/m1/s1 |
| InChIKey | KLRJIRHCALLJQF-BDJLRTHQSA-N |
| XLogP | 4.07 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|