C16H26NO7P — CID 614300
dimethyl 4-(diethoxyphosphorylmethyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 614300) has the molecular formula C16H26NO7P and a molecular weight of 375.36 g/mol. Its IUPAC name is dimethyl 4-(diethoxyphosphorylmethyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 4-(diethoxyphosphorylmethyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 614300 |
| Molecular Formula | C16H26NO7P |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | dimethyl 4-(diethoxyphosphorylmethyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOP(=O)(CC1C(C(=O)OC)=C(C)NC(C)=C1C(=O)OC)OCC |
| InChI | InChI=1S/C16H26NO7P/c1-7-23-25(20,24-8-2)9-12-13(15(18)21-5)10(3)17-11(4)14(12)16(19)22-6/h12,17H,7-9H2,1-6H3 |
| InChIKey | LXAJPPBLSJRDEZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|