C14H24BrO4P — CID 10642709
[(1R,4S)-3-bromo-1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl] diethyl phosphate (PubChem CID 10642709) has the molecular formula C14H24BrO4P and a molecular weight of 367.22 g/mol. Its IUPAC name is [(1R,4S)-3-bromo-1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl] diethyl phosphate.
| Compound Name | [(1R,4S)-3-bromo-1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl] diethyl phosphate |
|---|---|
| PubChem CID | 10642709 |
| Molecular Formula | C14H24BrO4P |
| Molecular Weight | 367.22 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | [(1R,4S)-3-bromo-1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OC1=C(Br)[C@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C14H24BrO4P/c1-6-17-20(16,18-7-2)19-12-11(15)10-8-9-14(12,5)13(10,3)4/h10H,6-9H2,1-5H3/t10-,14+/m1/s1 |
| InChIKey | NERPGPQPXADXQX-YGRLFVJLSA-N |
| XLogP | 5.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.22 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|