C23H33O5P — CID 11069835
[(8R,9S,10R,13S,14S)-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl] diethyl phosphate (PubChem CID 11069835) has the molecular formula C23H33O5P and a molecular weight of 420.49 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S)-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl] diethyl phosphate.
| Compound Name | [(8R,9S,10R,13S,14S)-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl] diethyl phosphate |
|---|---|
| PubChem CID | 11069835 |
| Molecular Formula | C23H33O5P |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | [(8R,9S,10R,13S,14S)-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OC1=CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H33O5P/c1-5-26-29(25,27-6-2)28-21-10-9-19-18-8-7-16-15-17(24)11-13-22(16,3)20(18)12-14-23(19,21)4/h10-11,13,15,18-20H,5-9,12,14H2,1-4H3/t18-,19-,20-,22-,23-/m0/s1 |
| InChIKey | DFZCMIXUJBORNO-CWMMHYCISA-N |
| XLogP | 5.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|