C25H37NO3 — CID 68718098
[(10R,13S,17S)-17-ethyl-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] N-propan-2-ylcarbamate (PubChem CID 68718098) has the molecular formula C25H37NO3 and a molecular weight of 399.58 g/mol. Its IUPAC name is [(10R,13S,17S)-17-ethyl-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] N-propan-2-ylcarbamate.
| Compound Name | [(10R,13S,17S)-17-ethyl-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 68718098 |
| Molecular Formula | C25H37NO3 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.28 |
| IUPAC Name | [(10R,13S,17S)-17-ethyl-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] N-propan-2-ylcarbamate |
| SMILES | CC[C@]1(OC(=O)NC(C)C)CCC2C3CCC4=CC(=O)C=C[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C25H37NO3/c1-6-25(29-22(28)26-16(2)3)14-11-21-19-8-7-17-15-18(27)9-12-23(17,4)20(19)10-13-24(21,25)5/h9,12,15-16,19-21H,6-8,10-11,13-14H2,1-5H3,(H,26,28)/t19?,20?,21?,23-,24-,25-/m0/s1 |
| InChIKey | HKRPHFJKSZFMRW-DWSVNQEMSA-N |
| XLogP | 5.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |