C20H25F3O2 — CID 12019719
(8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-17-(trifluoromethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 12019719) has the molecular formula C20H25F3O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-17-(trifluoromethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-17-(trifluoromethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 12019719 |
| Molecular Formula | C20H25F3O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | (8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-17-(trifluoromethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C=CC(=O)C=C1CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]2(O)C(F)(F)F |
| InChI | InChI=1S/C20H25F3O2/c1-17-8-5-13(24)11-12(17)3-4-14-15(17)6-9-18(2)16(14)7-10-19(18,25)20(21,22)23/h5,8,11,14-16,25H,3-4,6-7,9-10H2,1-2H3/t14-,15+,16+,17+,18+,19+/m1/s1 |
| InChIKey | CWARBXCWESKFKK-UGCZWRCOSA-N |
| XLogP | 4.59 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |