C21H25F5O2 — CID 10179354
(10R,13S,17R)-17-hydroxy-10,13-dimethyl-17-(1,1,2,2,2-pentafluoroethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 10179354) has the molecular formula C21H25F5O2 and a molecular weight of 404.42 g/mol. Its IUPAC name is (10R,13S,17R)-17-hydroxy-10,13-dimethyl-17-(1,1,2,2,2-pentafluoroethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (10R,13S,17R)-17-hydroxy-10,13-dimethyl-17-(1,1,2,2,2-pentafluoroethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 10179354 |
| Molecular Formula | C21H25F5O2 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | (10R,13S,17R)-17-hydroxy-10,13-dimethyl-17-(1,1,2,2,2-pentafluoroethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C=CC(=O)C=C1CCC1C2CC[C@@]2(C)C1CC[C@]2(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H25F5O2/c1-17-8-5-13(27)11-12(17)3-4-14-15(17)6-9-18(2)16(14)7-10-19(18,28)20(22,23)21(24,25)26/h5,8,11,14-16,28H,3-4,6-7,9-10H2,1-2H3/t14?,15?,16?,17-,18-,19+/m0/s1 |
| InChIKey | BTKONAOLKKYARG-JMVDCSAZSA-N |
| XLogP | 5.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|