C24H34O — CID 165145203
17-but-3-enyl-10,13,17-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 165145203) has the molecular formula C24H34O and a molecular weight of 338.54 g/mol. Its IUPAC name is 17-but-3-enyl-10,13,17-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | 17-but-3-enyl-10,13,17-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 165145203 |
| Molecular Formula | C24H34O |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | 17-but-3-enyl-10,13,17-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | C=CCCC1(C)CCC2C3CCC4=CC(=O)C=CC4(C)C3CCC21C |
| InChI | InChI=1S/C24H34O/c1-5-6-12-22(2)13-10-21-19-8-7-17-16-18(25)9-14-23(17,3)20(19)11-15-24(21,22)4/h5,9,14,16,19-21H,1,6-8,10-13,15H2,2-4H3 |
| InChIKey | JNAYIKOBLJQCFT-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|